About 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine
6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 82887464) has the molecular formula C11H14FNS
and a molecular weight of 211.30 g/mol. Its IUPAC name is 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine |
| PubChem CID | 82887464 |
| Molecular Formula | C11H14FNS |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CNC1c2cc(F)ccc2CSC1C |
| InChI | InChI=1S/C11H14FNS/c1-7-11(13-2)10-5-9(12)4-3-8(10)6-14-7/h3-5,7,11,13H,6H2,1-2H3 |
| InChIKey | JXPLRKVSNNCUKW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The IUPAC name of 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine (CID 82887464) is 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine.
What is the SMILES notation for 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The canonical SMILES for 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine is CNC1c2cc(F)ccc2CSC1C.
What is the InChIKey of 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The InChIKey is JXPLRKVSNNCUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNS/c1-7-11(13-2)10-5-9(12)4-3-8(10)6-14-7/h3-5,7,11,13H,6H2,1-2H3.
What are the key properties of 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine has a molecular weight of 211.30 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine is sourced from PubChem (CID 82887464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).