About N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine
N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 82887492) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine.
Molecular Properties
| Compound Name | N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine |
| PubChem CID | 82887492 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CCNC1CSCc2ccc(CC)cc21 |
| InChI | InChI=1S/C13H19NS/c1-3-10-5-6-11-8-15-9-13(14-4-2)12(11)7-10/h5-7,13-14H,3-4,8-9H2,1-2H3 |
| InChIKey | VWIYTKJUAPCHRP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The IUPAC name of N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine (CID 82887492) is N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine.
What is the SMILES notation for N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The canonical SMILES for N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine is CCNC1CSCc2ccc(CC)cc21.
What is the InChIKey of N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The InChIKey is VWIYTKJUAPCHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS/c1-3-10-5-6-11-8-15-9-13(14-4-2)12(11)7-10/h5-7,13-14H,3-4,8-9H2,1-2H3.
What are the key properties of N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine?
N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine has a molecular weight of 221.37 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-diethyl-3,4-dihydro-1H-isothiochromen-4-amine is sourced from PubChem (CID 82887492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).