C10H10F2OS — CID 82887546
(5S)-7,9-difluoro-1,3,4,5-tetrahydro-2-benzothiepin-5-ol (PubChem CID 82887546) has the molecular formula C10H10F2OS and a molecular weight of 216.25 g/mol. Its IUPAC name is (5S)-7,9-difluoro-1,3,4,5-tetrahydro-2-benzothiepin-5-ol.
| Compound Name | (5S)-7,9-difluoro-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
|---|---|
| PubChem CID | 82887546 |
| Molecular Formula | C10H10F2OS |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (5S)-7,9-difluoro-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
| SMILES | O[C@H]1CCSCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C10H10F2OS/c11-6-3-7-8(9(12)4-6)5-14-2-1-10(7)13/h3-4,10,13H,1-2,5H2/t10-/m0/s1 |
| InChIKey | PIYOQKIVLNOCQS-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |