About 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one
9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one (PubChem CID 82887735) has the molecular formula C11H11FOS
and a molecular weight of 210.27 g/mol. Its IUPAC name is 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one.
Molecular Properties
| Compound Name | 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one |
| PubChem CID | 82887735 |
| Molecular Formula | C11H11FOS |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one |
| SMILES | CC1CC(=O)c2cccc(F)c2CS1 |
| InChI | InChI=1S/C11H11FOS/c1-7-5-11(13)8-3-2-4-10(12)9(8)6-14-7/h2-4,7H,5-6H2,1H3 |
| InChIKey | SAGYULPQEJVDLM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one?
The IUPAC name of 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one (CID 82887735) is 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one.
What is the SMILES notation for 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one?
The canonical SMILES for 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one is CC1CC(=O)c2cccc(F)c2CS1.
What is the InChIKey of 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one?
The InChIKey is SAGYULPQEJVDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FOS/c1-7-5-11(13)8-3-2-4-10(12)9(8)6-14-7/h2-4,7H,5-6H2,1H3.
What are the key properties of 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one?
9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one has a molecular weight of 210.27 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3-methyl-3,4-dihydro-1H-2-benzothiepin-5-one is sourced from PubChem (CID 82887735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).