About 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine
5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine (PubChem CID 82888277) has the molecular formula C12H16FNOS
and a molecular weight of 241.33 g/mol. Its IUPAC name is 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine |
| PubChem CID | 82888277 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine |
| SMILES | COc1ccc(F)c2c1CSC(C)(C)C2N |
| InChI | InChI=1S/C12H16FNOS/c1-12(2)11(14)10-7(6-16-12)9(15-3)5-4-8(10)13/h4-5,11H,6,14H2,1-3H3 |
| InChIKey | VBNGSJGJYVCCFF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine?
The IUPAC name of 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine (CID 82888277) is 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine.
What is the SMILES notation for 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine?
The canonical SMILES for 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine is COc1ccc(F)c2c1CSC(C)(C)C2N.
What is the InChIKey of 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine?
The InChIKey is VBNGSJGJYVCCFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNOS/c1-12(2)11(14)10-7(6-16-12)9(15-3)5-4-8(10)13/h4-5,11H,6,14H2,1-3H3.
What are the key properties of 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine?
5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine has a molecular weight of 241.33 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-8-methoxy-3,3-dimethyl-1,4-dihydroisothiochromen-4-amine is sourced from PubChem (CID 82888277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).