C17H19NS — CID 82888356
N-methyl-7-phenyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine (PubChem CID 82888356) has the molecular formula C17H19NS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-methyl-7-phenyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine.
| Compound Name | N-methyl-7-phenyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine |
|---|---|
| PubChem CID | 82888356 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-methyl-7-phenyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine |
| SMILES | CNC1CCSCc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C17H19NS/c1-18-17-9-10-19-12-15-8-7-14(11-16(15)17)13-5-3-2-4-6-13/h2-8,11,17-18H,9-10,12H2,1H3 |
| InChIKey | LMLORCJTPXXHJC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |