C12H5BrCl3FN2O — CID 82889174
5-bromo-2-chloro-N-(2,6-dichloro-4-fluorophenyl)pyridine-3-carboxamide (PubChem CID 82889174) has the molecular formula C12H5BrCl3FN2O and a molecular weight of 398.45 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,6-dichloro-4-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-(2,6-dichloro-4-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 82889174 |
| Molecular Formula | C12H5BrCl3FN2O |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,6-dichloro-4-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(F)cc1Cl)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C12H5BrCl3FN2O/c13-5-1-7(11(16)18-4-5)12(20)19-10-8(14)2-6(17)3-9(10)15/h1-4H,(H,19,20) |
| InChIKey | GSAIFILUPRNFNY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|