About 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine
2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine (PubChem CID 82889191) has the molecular formula C13H30N4
and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine |
| PubChem CID | 82889191 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine |
| SMILES | CCC(C)(CN)N(C)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C13H30N4/c1-5-13(2,12-14)16(4)8-11-17-9-6-15(3)7-10-17/h5-12,14H2,1-4H3 |
| InChIKey | QFUZJCGEMLHHSM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine?
The IUPAC name of 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine (CID 82889191) is 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine.
What is the SMILES notation for 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine?
The canonical SMILES for 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine is CCC(C)(CN)N(C)CCN1CCN(C)CC1.
What is the InChIKey of 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine?
The InChIKey is QFUZJCGEMLHHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N4/c1-5-13(2,12-14)16(4)8-11-17-9-6-15(3)7-10-17/h5-12,14H2,1-4H3.
What are the key properties of 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine?
2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine has a molecular weight of 242.41 g/mol, XLogP of 0.29, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-dimethyl-2-N-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,2-diamine is sourced from PubChem (CID 82889191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).