C15H23NO2S — CID 82889922
6,7-dimethoxy-N,4,9-trimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine (PubChem CID 82889922) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 6,7-dimethoxy-N,4,9-trimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine.
| Compound Name | 6,7-dimethoxy-N,4,9-trimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine |
|---|---|
| PubChem CID | 82889922 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6,7-dimethoxy-N,4,9-trimethyl-1,3,4,5-tetrahydro-2-benzothiepin-5-amine |
| SMILES | CNC1c2c(c(C)cc(OC)c2OC)CSCC1C |
| InChI | InChI=1S/C15H23NO2S/c1-9-6-12(17-4)15(18-5)13-11(9)8-19-7-10(2)14(13)16-3/h6,10,14,16H,7-8H2,1-5H3 |
| InChIKey | RBSHMCCABLJESU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |