5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid

C11H13ClO6S — CID 82891231

IUPAC5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid
SMILESCc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)CC(O)CO
InChIInChI=1S/C11H13ClO6S/c1-6-9(11(15)16)2-7(12)3-10(6)19(17,18)5-8(14)4-13/h2-3,8,13-14H,4-5H2,1H3,(H,15,16)
InChIKeyBSLDFCAIMFCIFC-UHFFFAOYSA-N
MW308.74 g/mol
LogP0.47
Rot. Bonds5

About 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid

5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid (PubChem CID 82891231) has the molecular formula C11H13ClO6S and a molecular weight of 308.74 g/mol. Its IUPAC name is 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid.

Molecular Properties

Compound Name5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid
PubChem CID82891231
Molecular FormulaC11H13ClO6S
Molecular Weight308.74 g/mol
Exact Mass308.01
IUPAC Name5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid
SMILESCc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)CC(O)CO
InChIInChI=1S/C11H13ClO6S/c1-6-9(11(15)16)2-7(12)3-10(6)19(17,18)5-8(14)4-13/h2-3,8,13-14H,4-5H2,1H3,(H,15,16)
InChIKeyBSLDFCAIMFCIFC-UHFFFAOYSA-N
XLogP0.47
TPSA111.90 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.74
LogP ≤ 50.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid?
The IUPAC name of 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid (CID 82891231) is 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid.
What is the SMILES notation for 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid?
The canonical SMILES for 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid is Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)CC(O)CO.
What is the InChIKey of 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid?
The InChIKey is BSLDFCAIMFCIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO6S/c1-6-9(11(15)16)2-7(12)3-10(6)19(17,18)5-8(14)4-13/h2-3,8,13-14H,4-5H2,1H3,(H,15,16).
What are the key properties of 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid?
5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid has a molecular weight of 308.74 g/mol, XLogP of 0.47, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2,3-dihydroxypropylsulfonyl)-2-methylbenzoic acid is sourced from PubChem (CID 82891231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).