C13H24N4O2 — CID 82892131
3,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]piperazine-2,6-dione (PubChem CID 82892131) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 82892131 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3,3-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]piperazine-2,6-dione |
| SMILES | CN1CCN(CCN2C(=O)CNC(C)(C)C2=O)CC1 |
| InChI | InChI=1S/C13H24N4O2/c1-13(2)12(19)17(11(18)10-14-13)9-8-16-6-4-15(3)5-7-16/h14H,4-10H2,1-3H3 |
| InChIKey | KGVUSDNGSRLIAS-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|