C14H13Cl3N2O — CID 82893270
2,4,5-trichloro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline (PubChem CID 82893270) has the molecular formula C14H13Cl3N2O and a molecular weight of 331.63 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 82893270 |
| Molecular Formula | C14H13Cl3N2O |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2,4,5-trichloro-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline |
| SMILES | COc1cc(C)nc(CNc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H13Cl3N2O/c1-8-3-10(20-2)4-9(19-8)7-18-14-6-12(16)11(15)5-13(14)17/h3-6,18H,7H2,1-2H3 |
| InChIKey | XCIOMXGIEVGTFU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|