About 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid
2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid (PubChem CID 82893996) has the molecular formula C15H17NO2S2
and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid |
| PubChem CID | 82893996 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNCc2cc3c(s2)CCC3)s1 |
| InChI | InChI=1S/C15H17NO2S2/c17-15(18)7-11-4-5-12(19-11)8-16-9-13-6-10-2-1-3-14(10)20-13/h4-6,16H,1-3,7-9H2,(H,17,18) |
| InChIKey | YVSKJTPXCDJJHM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid?
The IUPAC name of 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid (CID 82893996) is 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid.
What is the SMILES notation for 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid?
The canonical SMILES for 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid is O=C(O)Cc1ccc(CNCc2cc3c(s2)CCC3)s1.
What is the InChIKey of 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid?
The InChIKey is YVSKJTPXCDJJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S2/c17-15(18)7-11-4-5-12(19-11)8-16-9-13-6-10-2-1-3-14(10)20-13/h4-6,16H,1-3,7-9H2,(H,17,18).
What are the key properties of 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid?
2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid has a molecular weight of 307.44 g/mol, XLogP of 3.22, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]thiophen-2-yl]acetic acid is sourced from PubChem (CID 82893996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).