C14H21NO2S — CID 82894760
methyl 2-[5-[(cyclohexylamino)methyl]thiophen-2-yl]acetate (PubChem CID 82894760) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is methyl 2-[5-[(cyclohexylamino)methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[(cyclohexylamino)methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 82894760 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl 2-[5-[(cyclohexylamino)methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNC2CCCCC2)s1 |
| InChI | InChI=1S/C14H21NO2S/c1-17-14(16)9-12-7-8-13(18-12)10-15-11-5-3-2-4-6-11/h7-8,11,15H,2-6,9-10H2,1H3 |
| InChIKey | CHFWFQNDQFWWMJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |