About 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline
5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 82895537) has the molecular formula C12H10FN5O
and a molecular weight of 259.24 g/mol. Its IUPAC name is 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline.
Molecular Properties
| Compound Name | 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline |
| PubChem CID | 82895537 |
| Molecular Formula | C12H10FN5O |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cn1cncc1-c1noc(-c2ccc(F)cc2N)n1 |
| InChI | InChI=1S/C12H10FN5O/c1-18-6-15-5-10(18)11-16-12(19-17-11)8-3-2-7(13)4-9(8)14/h2-6H,14H2,1H3 |
| InChIKey | WTMUJMMZROQNLG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline?
The IUPAC name of 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline (CID 82895537) is 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline.
What is the SMILES notation for 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline?
The canonical SMILES for 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline is Cn1cncc1-c1noc(-c2ccc(F)cc2N)n1.
What is the InChIKey of 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline?
The InChIKey is WTMUJMMZROQNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FN5O/c1-18-6-15-5-10(18)11-16-12(19-17-11)8-3-2-7(13)4-9(8)14/h2-6H,14H2,1H3.
What are the key properties of 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline?
5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline has a molecular weight of 259.24 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[3-(3-methylimidazol-4-yl)-1,2,4-oxadiazol-5-yl]aniline is sourced from PubChem (CID 82895537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).