About 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one
1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one (PubChem CID 82896734) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one |
| PubChem CID | 82896734 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one |
| SMILES | Cc1noc(CNCCn2ccccc2=O)n1 |
| InChI | InChI=1S/C11H14N4O2/c1-9-13-10(17-14-9)8-12-5-7-15-6-3-2-4-11(15)16/h2-4,6,12H,5,7-8H2,1H3 |
| InChIKey | UAJFOEDGHQSCLB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one?
The IUPAC name of 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one (CID 82896734) is 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one.
What is the SMILES notation for 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one?
The canonical SMILES for 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one is Cc1noc(CNCCn2ccccc2=O)n1.
What is the InChIKey of 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one?
The InChIKey is UAJFOEDGHQSCLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-9-13-10(17-14-9)8-12-5-7-15-6-3-2-4-11(15)16/h2-4,6,12H,5,7-8H2,1H3.
What are the key properties of 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one?
1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one has a molecular weight of 234.26 g/mol, XLogP of 0.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]ethyl]pyridin-2-one is sourced from PubChem (CID 82896734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).