C13H21N3O — CID 82897538
1-[2-[3-(aminomethyl)piperidin-1-yl]ethyl]pyridin-2-one (PubChem CID 82897538) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[2-[3-(aminomethyl)piperidin-1-yl]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[3-(aminomethyl)piperidin-1-yl]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82897538 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[2-[3-(aminomethyl)piperidin-1-yl]ethyl]pyridin-2-one |
| SMILES | NCC1CCCN(CCn2ccccc2=O)C1 |
| InChI | InChI=1S/C13H21N3O/c14-10-12-4-3-6-15(11-12)8-9-16-7-2-1-5-13(16)17/h1-2,5,7,12H,3-4,6,8-11,14H2 |
| InChIKey | NGKPNAFWSUYSJH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |