C15H32N4OS — CID 82897683
N,N-bis[3-(dimethylamino)propyl]thiomorpholine-3-carboxamide (PubChem CID 82897683) has the molecular formula C15H32N4OS and a molecular weight of 316.51 g/mol. Its IUPAC name is N,N-bis[3-(dimethylamino)propyl]thiomorpholine-3-carboxamide.
| Compound Name | N,N-bis[3-(dimethylamino)propyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82897683 |
| Molecular Formula | C15H32N4OS |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N,N-bis[3-(dimethylamino)propyl]thiomorpholine-3-carboxamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)C1CSCCN1 |
| InChI | InChI=1S/C15H32N4OS/c1-17(2)8-5-10-19(11-6-9-18(3)4)15(20)14-13-21-12-7-16-14/h14,16H,5-13H2,1-4H3 |
| InChIKey | GUHXONISZUJKEV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |