C8H9N5O2S2 — CID 82899611
4-amino-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzenesulfonamide (PubChem CID 82899611) has the molecular formula C8H9N5O2S2 and a molecular weight of 271.33 g/mol. Its IUPAC name is 4-amino-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzenesulfonamide.
| Compound Name | 4-amino-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82899611 |
| Molecular Formula | C8H9N5O2S2 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-amino-3-(1H-1,2,4-triazol-5-ylsulfanyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C8H9N5O2S2/c9-6-2-1-5(17(10,14)15)3-7(6)16-8-11-4-12-13-8/h1-4H,9H2,(H2,10,14,15)(H,11,12,13) |
| InChIKey | MGKUQSAKOGMOGT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|