C9H11N5O3S2 — CID 82899801
4-amino-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide (PubChem CID 82899801) has the molecular formula C9H11N5O3S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-amino-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 4-amino-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 82899801 |
| Molecular Formula | C9H11N5O3S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-amino-3-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide |
| SMILES | Cn1c(Sc2cc(S(N)(=O)=O)ccc2N)n[nH]c1=O |
| InChI | InChI=1S/C9H11N5O3S2/c1-14-8(15)12-13-9(14)18-7-4-5(19(11,16)17)2-3-6(7)10/h2-4H,10H2,1H3,(H,12,15)(H2,11,16,17) |
| InChIKey | ZOEWPZSRDBTEKZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 136.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|