C9H12N2O3S2 — CID 82899958
4-amino-3-(oxetan-3-ylsulfanyl)benzenesulfonamide (PubChem CID 82899958) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-amino-3-(oxetan-3-ylsulfanyl)benzenesulfonamide.
| Compound Name | 4-amino-3-(oxetan-3-ylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82899958 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-amino-3-(oxetan-3-ylsulfanyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1SC1COC1 |
| InChI | InChI=1S/C9H12N2O3S2/c10-8-2-1-7(16(11,12)13)3-9(8)15-6-4-14-5-6/h1-3,6H,4-5,10H2,(H2,11,12,13) |
| InChIKey | SNFWUQWPIAFSFC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|