C12H14N2O3S — CID 82900776
4-(2-pyridin-3-ylacetyl)thiomorpholine-3-carboxylic acid (PubChem CID 82900776) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-(2-pyridin-3-ylacetyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(2-pyridin-3-ylacetyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82900776 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-(2-pyridin-3-ylacetyl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)Cc1cccnc1 |
| InChI | InChI=1S/C12H14N2O3S/c15-11(6-9-2-1-3-13-7-9)14-4-5-18-8-10(14)12(16)17/h1-3,7,10H,4-6,8H2,(H,16,17) |
| InChIKey | NRKXBIHFOCBBOM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |