About 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid (PubChem CID 82901153) has the molecular formula C13H15N3O2S2
and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid |
| PubChem CID | 82901153 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid |
| SMILES | Cc1sc2ncnc(N3CCSCC3C(=O)O)c2c1C |
| InChI | InChI=1S/C13H15N3O2S2/c1-7-8(2)20-12-10(7)11(14-6-15-12)16-3-4-19-5-9(16)13(17)18/h6,9H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | VKXMMAWZIKAUTG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid?
The IUPAC name of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid (CID 82901153) is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid.
What is the SMILES notation for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid?
The canonical SMILES for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid is Cc1sc2ncnc(N3CCSCC3C(=O)O)c2c1C.
What is the InChIKey of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid?
The InChIKey is VKXMMAWZIKAUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S2/c1-7-8(2)20-12-10(7)11(14-6-15-12)16-3-4-19-5-9(16)13(17)18/h6,9H,3-5H2,1-2H3,(H,17,18).
What are the key properties of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid?
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid has a molecular weight of 309.42 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)thiomorpholine-3-carboxylic acid is sourced from PubChem (CID 82901153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).