About 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid
2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid (PubChem CID 82901814) has the molecular formula C10H9F3N2O4
and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid |
| PubChem CID | 82901814 |
| Molecular Formula | C10H9F3N2O4 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid |
| SMILES | O=C(Cn1ccc(C(=O)O)cc1=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O4/c11-10(12,13)5-14-7(16)4-15-2-1-6(9(18)19)3-8(15)17/h1-3H,4-5H2,(H,14,16)(H,18,19) |
| InChIKey | GDSGJZFZGGHCEI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid?
The IUPAC name of 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid (CID 82901814) is 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid.
What is the SMILES notation for 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid?
The canonical SMILES for 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid is O=C(Cn1ccc(C(=O)O)cc1=O)NCC(F)(F)F.
What is the InChIKey of 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid?
The InChIKey is GDSGJZFZGGHCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O4/c11-10(12,13)5-14-7(16)4-15-2-1-6(9(18)19)3-8(15)17/h1-3H,4-5H2,(H,14,16)(H,18,19).
What are the key properties of 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid?
2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid has a molecular weight of 278.19 g/mol, XLogP of 0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyridine-4-carboxylic acid is sourced from PubChem (CID 82901814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).