C13H20N4O3S — CID 82902271
4-amino-N-ethyl-3-(5-oxo-1,4-diazepan-1-yl)benzenesulfonamide (PubChem CID 82902271) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-(5-oxo-1,4-diazepan-1-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-ethyl-3-(5-oxo-1,4-diazepan-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 82902271 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-amino-N-ethyl-3-(5-oxo-1,4-diazepan-1-yl)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(N2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C13H20N4O3S/c1-2-16-21(19,20)10-3-4-11(14)12(9-10)17-7-5-13(18)15-6-8-17/h3-4,9,16H,2,5-8,14H2,1H3,(H,15,18) |
| InChIKey | RYPKWENPFDFJKG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|