C15H24N2O3S — CID 82903113
4-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonyl)thiomorpholine-3-carboxylic acid (PubChem CID 82903113) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82903113 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonyl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C15H24N2O3S/c18-14(17-7-8-21-9-13(17)15(19)20)12-6-5-10-3-1-2-4-11(10)16-12/h10-13,16H,1-9H2,(H,19,20) |
| InChIKey | AGMLLWGCQGJVOU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |