About N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide
N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 82903394) has the molecular formula C8H16F3NO2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide |
| PubChem CID | 82903394 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-3-7(2)12-15(13,14)6-4-5-8(9,10)11/h7,12H,3-6H2,1-2H3 |
| InChIKey | GQGMREHZDJBOKA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide?
The IUPAC name of N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide (CID 82903394) is N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide.
What is the SMILES notation for N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide?
The canonical SMILES for N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide is CCC(C)NS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide?
The InChIKey is GQGMREHZDJBOKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2S/c1-3-7(2)12-15(13,14)6-4-5-8(9,10)11/h7,12H,3-6H2,1-2H3.
What are the key properties of N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide?
N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide has a molecular weight of 247.28 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-4,4,4-trifluorobutane-1-sulfonamide is sourced from PubChem (CID 82903394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).