About N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide
N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide (PubChem CID 82903400) has the molecular formula C10H17F3N2O3S
and a molecular weight of 302.32 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide |
| PubChem CID | 82903400 |
| Molecular Formula | C10H17F3N2O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide |
| SMILES | COCCN(CCC#N)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3S/c1-18-8-7-15(6-3-5-14)19(16,17)9-2-4-10(11,12)13/h2-4,6-9H2,1H3 |
| InChIKey | NVULQEWQNKFXNX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide?
The IUPAC name of N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide (CID 82903400) is N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide.
What is the SMILES notation for N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide?
The canonical SMILES for N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide is COCCN(CCC#N)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide?
The InChIKey is NVULQEWQNKFXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O3S/c1-18-8-7-15(6-3-5-14)19(16,17)9-2-4-10(11,12)13/h2-4,6-9H2,1H3.
What are the key properties of N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide?
N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide has a molecular weight of 302.32 g/mol, XLogP of 1.52, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-4,4,4-trifluoro-N-(2-methoxyethyl)butane-1-sulfonamide is sourced from PubChem (CID 82903400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).