C10H17F3N2O3S — CID 82903557
3,3-dimethyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one (PubChem CID 82903557) has the molecular formula C10H17F3N2O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is 3,3-dimethyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one |
|---|---|
| PubChem CID | 82903557 |
| Molecular Formula | C10H17F3N2O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3,3-dimethyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3S/c1-9(2)8(16)14-5-6-15(9)19(17,18)7-3-4-10(11,12)13/h3-7H2,1-2H3,(H,14,16) |
| InChIKey | WIJZJSRTZYAHTA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |