About N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide
N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 82903698) has the molecular formula C8H13F3N2O2S
and a molecular weight of 258.26 g/mol. Its IUPAC name is N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide |
| PubChem CID | 82903698 |
| Molecular Formula | C8H13F3N2O2S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(C#N)CNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O2S/c1-7(5-12)6-13-16(14,15)4-2-3-8(9,10)11/h7,13H,2-4,6H2,1H3 |
| InChIKey | KMCKWCNMKNAWGW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide?
The IUPAC name of N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide (CID 82903698) is N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide.
What is the SMILES notation for N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide?
The canonical SMILES for N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide is CC(C#N)CNS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide?
The InChIKey is KMCKWCNMKNAWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O2S/c1-7(5-12)6-13-16(14,15)4-2-3-8(9,10)11/h7,13H,2-4,6H2,1H3.
What are the key properties of N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide?
N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide has a molecular weight of 258.26 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanopropyl)-4,4,4-trifluorobutane-1-sulfonamide is sourced from PubChem (CID 82903698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).