About N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide
N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 82903856) has the molecular formula C9H16F3NO2S
and a molecular weight of 259.29 g/mol. Its IUPAC name is N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide |
| PubChem CID | 82903856 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C9H16F3NO2S/c10-9(11,12)6-3-7-16(14,15)13-8-4-1-2-5-8/h8,13H,1-7H2 |
| InChIKey | VRFPXOUIEXICNP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide?
The IUPAC name of N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide (CID 82903856) is N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide.
What is the SMILES notation for N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide?
The canonical SMILES for N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide is O=S(=O)(CCCC(F)(F)F)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide?
The InChIKey is VRFPXOUIEXICNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2S/c10-9(11,12)6-3-7-16(14,15)13-8-4-1-2-5-8/h8,13H,1-7H2.
What are the key properties of N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide?
N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide has a molecular weight of 259.29 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-4,4,4-trifluorobutane-1-sulfonamide is sourced from PubChem (CID 82903856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).