About 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid
4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid (PubChem CID 82904167) has the molecular formula C11H15N3O2S
and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid |
| PubChem CID | 82904167 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid |
| SMILES | Cc1cnc(C)c(N2CCSCC2C(=O)O)n1 |
| InChI | InChI=1S/C11H15N3O2S/c1-7-5-12-8(2)10(13-7)14-3-4-17-6-9(14)11(15)16/h5,9H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | WWGIZGXRDMZNNK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid?
The IUPAC name of 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid (CID 82904167) is 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid.
What is the SMILES notation for 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid?
The canonical SMILES for 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid is Cc1cnc(C)c(N2CCSCC2C(=O)O)n1.
What is the InChIKey of 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid?
The InChIKey is WWGIZGXRDMZNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S/c1-7-5-12-8(2)10(13-7)14-3-4-17-6-9(14)11(15)16/h5,9H,3-4,6H2,1-2H3,(H,15,16).
What are the key properties of 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid?
4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid has a molecular weight of 253.33 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,6-dimethylpyrazin-2-yl)thiomorpholine-3-carboxylic acid is sourced from PubChem (CID 82904167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).