C11H15N5O3S — CID 82904679
4-[1-(azetidin-3-yl)triazole-4-carbonyl]thiomorpholine-3-carboxylic acid (PubChem CID 82904679) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[1-(azetidin-3-yl)triazole-4-carbonyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[1-(azetidin-3-yl)triazole-4-carbonyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82904679 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-[1-(azetidin-3-yl)triazole-4-carbonyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C11H15N5O3S/c17-10(15-1-2-20-6-9(15)11(18)19)8-5-16(14-13-8)7-3-12-4-7/h5,7,9,12H,1-4,6H2,(H,18,19) |
| InChIKey | GRGJZCXPGRKNOA-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |