C12H21N3O3S — CID 82904716
4-[(1-methylpyrrolidin-3-yl)methylcarbamoyl]thiomorpholine-3-carboxylic acid (PubChem CID 82904716) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-[(1-methylpyrrolidin-3-yl)methylcarbamoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(1-methylpyrrolidin-3-yl)methylcarbamoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82904716 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-[(1-methylpyrrolidin-3-yl)methylcarbamoyl]thiomorpholine-3-carboxylic acid |
| SMILES | CN1CCC(CNC(=O)N2CCSCC2C(=O)O)C1 |
| InChI | InChI=1S/C12H21N3O3S/c1-14-3-2-9(7-14)6-13-12(18)15-4-5-19-8-10(15)11(16)17/h9-10H,2-8H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | QVFAUBNXPXIKDD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |