C9H14N2O2S — CID 82906268
2-propan-2-yl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione (PubChem CID 82906268) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-propan-2-yl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione.
| Compound Name | 2-propan-2-yl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione |
|---|---|
| PubChem CID | 82906268 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-propan-2-yl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione |
| SMILES | CC(C)N1C(=O)C2CSCCN2C1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-6(2)11-8(12)7-5-14-4-3-10(7)9(11)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | SXVRGSQUVYTVPS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|