C12H22N2O3S — CID 82906329
4-[1-(butan-2-ylamino)-1-oxopropan-2-yl]thiomorpholine-3-carboxylic acid (PubChem CID 82906329) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-[1-(butan-2-ylamino)-1-oxopropan-2-yl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[1-(butan-2-ylamino)-1-oxopropan-2-yl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82906329 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[1-(butan-2-ylamino)-1-oxopropan-2-yl]thiomorpholine-3-carboxylic acid |
| SMILES | CCC(C)NC(=O)C(C)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C12H22N2O3S/c1-4-8(2)13-11(15)9(3)14-5-6-18-7-10(14)12(16)17/h8-10H,4-7H2,1-3H3,(H,13,15)(H,16,17) |
| InChIKey | DRARHMAYRIXUBI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |