4-pent-4-enylthiomorpholine-3-carboxylic acid

C10H17NO2S — CID 82906566

IUPAC4-pent-4-enylthiomorpholine-3-carboxylic acid
SMILESC=CCCCN1CCSCC1C(=O)O
InChIInChI=1S/C10H17NO2S/c1-2-3-4-5-11-6-7-14-8-9(11)10(12)13/h2,9H,1,3-8H2,(H,12,13)
InChIKeyIGGLMCIRSCXSGH-UHFFFAOYSA-N
MW215.32 g/mol
LogP1.45
Rot. Bonds5

About 4-pent-4-enylthiomorpholine-3-carboxylic acid

4-pent-4-enylthiomorpholine-3-carboxylic acid (PubChem CID 82906566) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 4-pent-4-enylthiomorpholine-3-carboxylic acid.

Molecular Properties

Compound Name4-pent-4-enylthiomorpholine-3-carboxylic acid
PubChem CID82906566
Molecular FormulaC10H17NO2S
Molecular Weight215.32 g/mol
Exact Mass215.10
IUPAC Name4-pent-4-enylthiomorpholine-3-carboxylic acid
SMILESC=CCCCN1CCSCC1C(=O)O
InChIInChI=1S/C10H17NO2S/c1-2-3-4-5-11-6-7-14-8-9(11)10(12)13/h2,9H,1,3-8H2,(H,12,13)
InChIKeyIGGLMCIRSCXSGH-UHFFFAOYSA-N
XLogP1.45
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.32
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-pent-4-enylthiomorpholine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-[3-(dimethylamino)propyl]thiomorpholine-3-carboxylic acid
CID 114525954
4-(3-methylsulfonylpropyl)thiomorpholine-3-carboxylic acid
CID 82905864
4-(3-methylbut-3-enyl)thiomorpholine-3-carboxylic acid
CID 114473231
4-(4-cyano-4-methylpentyl)thiomorpholine-3-carboxylic acid
CID 82906395
methyl 2-[(3S)-4-pent-4-enylthiomorpholin-3-yl]acetate
CID 97062569
4-[2-(dimethylamino)ethyl]thiomorpholine-3-carboxylic acid
CID 82905755
4-ethyl-1-pent-4-enylpiperidine-2-carboxylic acid
CID 114431232
4-(2-morpholin-4-ylethyl)thiomorpholine-3-carboxylic acid
CID 82906797
1-hept-6-enylpiperazine-2-carboxylic acid
CID 107008029
4-[2-(2-methoxyethoxy)ethyl]thiomorpholine-3-carboxylic acid
CID 82909368
4-ethyl-1-hept-6-enylpiperidine-2-carboxylic acid
CID 107007902
4-(2-propylsulfonylethyl)thiomorpholine-3-carboxylic acid
CID 106727669

Frequently Asked Questions

What is the IUPAC name of 4-pent-4-enylthiomorpholine-3-carboxylic acid?
The IUPAC name of 4-pent-4-enylthiomorpholine-3-carboxylic acid (CID 82906566) is 4-pent-4-enylthiomorpholine-3-carboxylic acid.
What is the SMILES notation for 4-pent-4-enylthiomorpholine-3-carboxylic acid?
The canonical SMILES for 4-pent-4-enylthiomorpholine-3-carboxylic acid is C=CCCCN1CCSCC1C(=O)O.
What is the InChIKey of 4-pent-4-enylthiomorpholine-3-carboxylic acid?
The InChIKey is IGGLMCIRSCXSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-2-3-4-5-11-6-7-14-8-9(11)10(12)13/h2,9H,1,3-8H2,(H,12,13).
What are the key properties of 4-pent-4-enylthiomorpholine-3-carboxylic acid?
4-pent-4-enylthiomorpholine-3-carboxylic acid has a molecular weight of 215.32 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pent-4-enylthiomorpholine-3-carboxylic acid is sourced from PubChem (CID 82906566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).