About 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one
1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one (PubChem CID 82907135) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one |
| PubChem CID | 82907135 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one |
| SMILES | CC1(C)CN(CCn2ccccc2=O)C(C2CC2)CN1 |
| InChI | InChI=1S/C16H25N3O/c1-16(2)12-19(14(11-17-16)13-6-7-13)10-9-18-8-4-3-5-15(18)20/h3-5,8,13-14,17H,6-7,9-12H2,1-2H3 |
| InChIKey | CZECYZFQQIZRBI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one?
The IUPAC name of 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one (CID 82907135) is 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one.
What is the SMILES notation for 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one?
The canonical SMILES for 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one is CC1(C)CN(CCn2ccccc2=O)C(C2CC2)CN1.
What is the InChIKey of 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one?
The InChIKey is CZECYZFQQIZRBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-16(2)12-19(14(11-17-16)13-6-7-13)10-9-18-8-4-3-5-15(18)20/h3-5,8,13-14,17H,6-7,9-12H2,1-2H3.
What are the key properties of 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one?
1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one has a molecular weight of 275.40 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-cyclopropyl-5,5-dimethylpiperazin-1-yl)ethyl]pyridin-2-one is sourced from PubChem (CID 82907135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).