C15H23N3O — CID 82907258
1-[2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]pyridin-2-one (PubChem CID 82907258) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]pyridin-2-one.
| Compound Name | 1-[2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82907258 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-[2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]pyridin-2-one |
| SMILES | CCC1C2CNCC2CN1CCn1ccccc1=O |
| InChI | InChI=1S/C15H23N3O/c1-2-14-13-10-16-9-12(13)11-18(14)8-7-17-6-4-3-5-15(17)19/h3-6,12-14,16H,2,7-11H2,1H3 |
| InChIKey | FFXZPXBQYYMDPC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |