C11H15BrN2OS2 — CID 82908410
N-[(5-bromothiophen-3-yl)methyl]-N-methylthiomorpholine-3-carboxamide (PubChem CID 82908410) has the molecular formula C11H15BrN2OS2 and a molecular weight of 335.29 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methylthiomorpholine-3-carboxamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908410 |
| Molecular Formula | C11H15BrN2OS2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methylthiomorpholine-3-carboxamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)C1CSCCN1 |
| InChI | InChI=1S/C11H15BrN2OS2/c1-14(5-8-4-10(12)17-6-8)11(15)9-7-16-3-2-13-9/h4,6,9,13H,2-3,5,7H2,1H3 |
| InChIKey | LUXOBJCZLZEGDU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |