C11H13ClN2S — CID 82908449
10-chloro-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoxaline (PubChem CID 82908449) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 10-chloro-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoxaline.
| Compound Name | 10-chloro-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 82908449 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 10-chloro-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoxaline |
| SMILES | Clc1cccc2c1N1CCSCC1CN2 |
| InChI | InChI=1S/C11H13ClN2S/c12-9-2-1-3-10-11(9)14-4-5-15-7-8(14)6-13-10/h1-3,8,13H,4-7H2 |
| InChIKey | CATHPKUIRUNEQO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |