C12H18N2OS2 — CID 82908664
N-(1-thiophen-3-ylpropan-2-yl)thiomorpholine-3-carboxamide (PubChem CID 82908664) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(1-thiophen-3-ylpropan-2-yl)thiomorpholine-3-carboxamide.
| Compound Name | N-(1-thiophen-3-ylpropan-2-yl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908664 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(1-thiophen-3-ylpropan-2-yl)thiomorpholine-3-carboxamide |
| SMILES | CC(Cc1ccsc1)NC(=O)C1CSCCN1 |
| InChI | InChI=1S/C12H18N2OS2/c1-9(6-10-2-4-16-7-10)14-12(15)11-8-17-5-3-13-11/h2,4,7,9,11,13H,3,5-6,8H2,1H3,(H,14,15) |
| InChIKey | WKNCFEINJTWQTJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |