C14H21N3OS — CID 82909258
N-[[4-(dimethylamino)phenyl]methyl]thiomorpholine-3-carboxamide (PubChem CID 82909258) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82909258 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]thiomorpholine-3-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C2CSCCN2)cc1 |
| InChI | InChI=1S/C14H21N3OS/c1-17(2)12-5-3-11(4-6-12)9-16-14(18)13-10-19-8-7-15-13/h3-6,13,15H,7-10H2,1-2H3,(H,16,18) |
| InChIKey | AQCXGLSOOJCBRT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|