1-but-2-ynylpyrazole-4-sulfonyl chloride

C7H7ClN2O2S — CID 82911175

IUPAC1-but-2-ynylpyrazole-4-sulfonyl chloride
SMILESCC#CCn1cc(S(=O)(=O)Cl)cn1
InChIInChI=1S/C7H7ClN2O2S/c1-2-3-4-10-6-7(5-9-10)13(8,11)12/h5-6H,4H2,1H3
InChIKeyNEACCDVRDGGOJL-UHFFFAOYSA-N
MW218.66 g/mol
LogP0.83
Rot. Bonds2

About 1-but-2-ynylpyrazole-4-sulfonyl chloride

1-but-2-ynylpyrazole-4-sulfonyl chloride (PubChem CID 82911175) has the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. Its IUPAC name is 1-but-2-ynylpyrazole-4-sulfonyl chloride.

Molecular Properties

Compound Name1-but-2-ynylpyrazole-4-sulfonyl chloride
PubChem CID82911175
Molecular FormulaC7H7ClN2O2S
Molecular Weight218.66 g/mol
Exact Mass217.99
IUPAC Name1-but-2-ynylpyrazole-4-sulfonyl chloride
SMILESCC#CCn1cc(S(=O)(=O)Cl)cn1
InChIInChI=1S/C7H7ClN2O2S/c1-2-3-4-10-6-7(5-9-10)13(8,11)12/h5-6H,4H2,1H3
InChIKeyNEACCDVRDGGOJL-UHFFFAOYSA-N
XLogP0.83
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.66
LogP ≤ 50.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 1-but-2-ynylpyrazole-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-but-2-ynylpyrazole-4-sulfonyl chloride?
The IUPAC name of 1-but-2-ynylpyrazole-4-sulfonyl chloride (CID 82911175) is 1-but-2-ynylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1-but-2-ynylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 1-but-2-ynylpyrazole-4-sulfonyl chloride is CC#CCn1cc(S(=O)(=O)Cl)cn1.
What is the InChIKey of 1-but-2-ynylpyrazole-4-sulfonyl chloride?
The InChIKey is NEACCDVRDGGOJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O2S/c1-2-3-4-10-6-7(5-9-10)13(8,11)12/h5-6H,4H2,1H3.
What are the key properties of 1-but-2-ynylpyrazole-4-sulfonyl chloride?
1-but-2-ynylpyrazole-4-sulfonyl chloride has a molecular weight of 218.66 g/mol, XLogP of 0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-ynylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 82911175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).