About 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride
2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride (PubChem CID 82912073) has the molecular formula C9H12ClN5O2S
and a molecular weight of 289.75 g/mol. Its IUPAC name is 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride |
| PubChem CID | 82912073 |
| Molecular Formula | C9H12ClN5O2S |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride |
| SMILES | CCc1nc(S(=O)(=O)Cl)cn1Cc1nncn1C |
| InChI | InChI=1S/C9H12ClN5O2S/c1-3-7-12-9(18(10,16)17)5-15(7)4-8-13-11-6-14(8)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | VDGICAGLEDRVKN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride?
The IUPAC name of 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride (CID 82912073) is 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride.
What is the SMILES notation for 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride?
The canonical SMILES for 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride is CCc1nc(S(=O)(=O)Cl)cn1Cc1nncn1C.
What is the InChIKey of 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride?
The InChIKey is VDGICAGLEDRVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN5O2S/c1-3-7-12-9(18(10,16)17)5-15(7)4-8-13-11-6-14(8)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride?
2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride has a molecular weight of 289.75 g/mol, XLogP of 0.55, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]imidazole-4-sulfonyl chloride is sourced from PubChem (CID 82912073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).