C6H8ClN3O3S — CID 82912245
1-(3-amino-3-oxopropyl)imidazole-4-sulfonyl chloride (PubChem CID 82912245) has the molecular formula C6H8ClN3O3S and a molecular weight of 237.67 g/mol. Its IUPAC name is 1-(3-amino-3-oxopropyl)imidazole-4-sulfonyl chloride.
| Compound Name | 1-(3-amino-3-oxopropyl)imidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 82912245 |
| Molecular Formula | C6H8ClN3O3S |
| Molecular Weight | 237.67 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 1-(3-amino-3-oxopropyl)imidazole-4-sulfonyl chloride |
| SMILES | NC(=O)CCn1cnc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C6H8ClN3O3S/c7-14(12,13)6-3-10(4-9-6)2-1-5(8)11/h3-4H,1-2H2,(H2,8,11) |
| InChIKey | OGRIYAXLVULVCT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.67 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |