C11H13ClN2O6S — CID 82912550
4-(1-amino-1-oxobutan-2-yl)oxy-2-methyl-5-nitrobenzenesulfonyl chloride (PubChem CID 82912550) has the molecular formula C11H13ClN2O6S and a molecular weight of 336.75 g/mol. Its IUPAC name is 4-(1-amino-1-oxobutan-2-yl)oxy-2-methyl-5-nitrobenzenesulfonyl chloride.
| Compound Name | 4-(1-amino-1-oxobutan-2-yl)oxy-2-methyl-5-nitrobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82912550 |
| Molecular Formula | C11H13ClN2O6S |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 4-(1-amino-1-oxobutan-2-yl)oxy-2-methyl-5-nitrobenzenesulfonyl chloride |
| SMILES | CCC(Oc1cc(C)c(S(=O)(=O)Cl)cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C11H13ClN2O6S/c1-3-8(11(13)15)20-9-4-6(2)10(21(12,18)19)5-7(9)14(16)17/h4-5,8H,3H2,1-2H3,(H2,13,15) |
| InChIKey | ZXNRVOHCSOBNIG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|