About 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride
3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride (PubChem CID 82913581) has the molecular formula C7H6ClF3N4O5S
and a molecular weight of 350.66 g/mol. Its IUPAC name is 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride |
| PubChem CID | 82913581 |
| Molecular Formula | C7H6ClF3N4O5S |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cl)c([N+](=O)[O-])n1)NCC(F)(F)F |
| InChI | InChI=1S/C7H6ClF3N4O5S/c8-21(19,20)4-1-14(13-6(4)15(17)18)2-5(16)12-3-7(9,10)11/h1H,2-3H2,(H,12,16) |
| InChIKey | BZKQCSGHIWUAFO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride?
The IUPAC name of 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride (CID 82913581) is 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride.
What is the SMILES notation for 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride?
The canonical SMILES for 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride is O=C(Cn1cc(S(=O)(=O)Cl)c([N+](=O)[O-])n1)NCC(F)(F)F.
What is the InChIKey of 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride?
The InChIKey is BZKQCSGHIWUAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF3N4O5S/c8-21(19,20)4-1-14(13-6(4)15(17)18)2-5(16)12-3-7(9,10)11/h1H,2-3H2,(H,12,16).
What are the key properties of 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride?
3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride has a molecular weight of 350.66 g/mol, XLogP of 0.40, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]pyrazole-4-sulfonyl chloride is sourced from PubChem (CID 82913581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).