C13H17N3O4S — CID 82913600
3-tert-butyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide (PubChem CID 82913600) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-tert-butyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide.
| Compound Name | 3-tert-butyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82913600 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-tert-butyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide |
| SMILES | CC(C)(C)c1cc(S(N)(=O)=O)ccc1OCc1ncon1 |
| InChI | InChI=1S/C13H17N3O4S/c1-13(2,3)10-6-9(21(14,17)18)4-5-11(10)19-7-12-15-8-20-16-12/h4-6,8H,7H2,1-3H3,(H2,14,17,18) |
| InChIKey | WHNKKNAOYKJBRZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |