About 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide
2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide (PubChem CID 82914735) has the molecular formula C11H14N2O5S
and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide |
| PubChem CID | 82914735 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide |
| SMILES | Cc1cc(OCC2CNC(=O)O2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H14N2O5S/c1-7-4-8(2-3-10(7)19(12,15)16)17-6-9-5-13-11(14)18-9/h2-4,9H,5-6H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | IIYLMOOZWICFBB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide?
The IUPAC name of 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide (CID 82914735) is 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide.
What is the SMILES notation for 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide?
The canonical SMILES for 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide is Cc1cc(OCC2CNC(=O)O2)ccc1S(N)(=O)=O.
What is the InChIKey of 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide?
The InChIKey is IIYLMOOZWICFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O5S/c1-7-4-8(2-3-10(7)19(12,15)16)17-6-9-5-13-11(14)18-9/h2-4,9H,5-6H2,1H3,(H,13,14)(H2,12,15,16).
What are the key properties of 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide?
2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide has a molecular weight of 286.31 g/mol, XLogP of 0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]benzenesulfonamide is sourced from PubChem (CID 82914735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).